C20H25NO3S — CID 110326607
2-(4-methylphenyl)-4-(3-phenylpropylsulfonyl)morpholine (PubChem CID 110326607) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-(3-phenylpropylsulfonyl)morpholine.
| Compound Name | 2-(4-methylphenyl)-4-(3-phenylpropylsulfonyl)morpholine |
|---|---|
| PubChem CID | 110326607 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-(4-methylphenyl)-4-(3-phenylpropylsulfonyl)morpholine |
| SMILES | Cc1ccc(C2CN(S(=O)(=O)CCCc3ccccc3)CCO2)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-17-9-11-19(12-10-17)20-16-21(13-14-24-20)25(22,23)15-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-12,20H,5,8,13-16H2,1H3 |
| InChIKey | JGJSMTWUSQDRFC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |