C24H29N3O4 — CID 16895045
N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]-N'-(2-phenylethyl)oxamide (PubChem CID 16895045) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]-N'-(2-phenylethyl)oxamide.
| Compound Name | N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]-N'-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 16895045 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]-N'-(2-phenylethyl)oxamide |
| SMILES | O=C(NCCCC(=O)N1CCOC(c2ccccc2)C1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C24H29N3O4/c28-22(27-16-17-31-21(18-27)20-10-5-2-6-11-20)12-7-14-25-23(29)24(30)26-15-13-19-8-3-1-4-9-19/h1-6,8-11,21H,7,12-18H2,(H,25,29)(H,26,30) |
| InChIKey | UEAPDWBMNCGKSC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|