C21H22ClFN2O3 — CID 16894866
2-chloro-6-fluoro-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]benzamide (PubChem CID 16894866) has the molecular formula C21H22ClFN2O3 and a molecular weight of 404.87 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]benzamide |
|---|---|
| PubChem CID | 16894866 |
| Molecular Formula | C21H22ClFN2O3 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-chloro-6-fluoro-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]benzamide |
| SMILES | O=C(NCCCC(=O)N1CCOC(c2ccccc2)C1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C21H22ClFN2O3/c22-16-8-4-9-17(23)20(16)21(27)24-11-5-10-19(26)25-12-13-28-18(14-25)15-6-2-1-3-7-15/h1-4,6-9,18H,5,10-14H2,(H,24,27) |
| InChIKey | OINXWAFQONPONA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|