C26H34N2O4 — CID 16894896
2-(4-tert-butylphenoxy)-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]acetamide (PubChem CID 16894896) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]acetamide |
|---|---|
| PubChem CID | 16894896 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[4-oxo-4-(2-phenylmorpholin-4-yl)butyl]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NCCCC(=O)N2CCOC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H34N2O4/c1-26(2,3)21-11-13-22(14-12-21)32-19-24(29)27-15-7-10-25(30)28-16-17-31-23(18-28)20-8-5-4-6-9-20/h4-6,8-9,11-14,23H,7,10,15-19H2,1-3H3,(H,27,29) |
| InChIKey | VIPUURISYRPCNX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|