C18H19NO4 — CID 110740320
(2,6-dimethoxyphenyl)-(2-phenyl-1,3-oxazolidin-3-yl)methanone (PubChem CID 110740320) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-(2-phenyl-1,3-oxazolidin-3-yl)methanone.
| Compound Name | (2,6-dimethoxyphenyl)-(2-phenyl-1,3-oxazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 110740320 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2,6-dimethoxyphenyl)-(2-phenyl-1,3-oxazolidin-3-yl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)N1CCOC1c1ccccc1 |
| InChI | InChI=1S/C18H19NO4/c1-21-14-9-6-10-15(22-2)16(14)17(20)19-11-12-23-18(19)13-7-4-3-5-8-13/h3-10,18H,11-12H2,1-2H3 |
| InChIKey | GIFHFLOQWJSWRN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |