C17H14N2O2 — CID 110740315
3-(2-phenyl-1,3-oxazolidine-3-carbonyl)benzonitrile (PubChem CID 110740315) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(2-phenyl-1,3-oxazolidine-3-carbonyl)benzonitrile.
| Compound Name | 3-(2-phenyl-1,3-oxazolidine-3-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 110740315 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(2-phenyl-1,3-oxazolidine-3-carbonyl)benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCOC2c2ccccc2)c1 |
| InChI | InChI=1S/C17H14N2O2/c18-12-13-5-4-8-15(11-13)16(20)19-9-10-21-17(19)14-6-2-1-3-7-14/h1-8,11,17H,9-10H2 |
| InChIKey | CYMHPZCKAFSULT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |