C15H18FNO5 — CID 125120396
(2S)-4-[4-(2-fluorophenoxy)butanoyl]morpholine-2-carboxylic acid (PubChem CID 125120396) has the molecular formula C15H18FNO5 and a molecular weight of 311.31 g/mol. Its IUPAC name is (2S)-4-[4-(2-fluorophenoxy)butanoyl]morpholine-2-carboxylic acid.
| Compound Name | (2S)-4-[4-(2-fluorophenoxy)butanoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 125120396 |
| Molecular Formula | C15H18FNO5 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2S)-4-[4-(2-fluorophenoxy)butanoyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)CCCOc2ccccc2F)CCO1 |
| InChI | InChI=1S/C15H18FNO5/c16-11-4-1-2-5-12(11)21-8-3-6-14(18)17-7-9-22-13(10-17)15(19)20/h1-2,4-5,13H,3,6-10H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | CMPUQPJQQKTOSR-ZDUSSCGKSA-N |
| XLogP | 1.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|