C20H21NO6 — CID 125154179
(2R)-4-[2-(2-phenoxyethoxy)benzoyl]morpholine-2-carboxylic acid (PubChem CID 125154179) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is (2R)-4-[2-(2-phenoxyethoxy)benzoyl]morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-[2-(2-phenoxyethoxy)benzoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 125154179 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (2R)-4-[2-(2-phenoxyethoxy)benzoyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)c2ccccc2OCCOc2ccccc2)CCO1 |
| InChI | InChI=1S/C20H21NO6/c22-19(21-10-11-26-18(14-21)20(23)24)16-8-4-5-9-17(16)27-13-12-25-15-6-2-1-3-7-15/h1-9,18H,10-14H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | YSBKBRBOXQXFIG-GOSISDBHSA-N |
| XLogP | 2.07 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|