C22H25NO4 — CID 133114354
[(3aR,5R,6R,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-phenylmethoxyphenyl)methanone (PubChem CID 133114354) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-phenylmethoxyphenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 133114354 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-phenylmethoxyphenyl)methanone |
| SMILES | O=C(c1ccccc1OCc1ccccc1)N1C[C@H]2C[C@@H](O)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C22H25NO4/c24-19-10-16-12-23(13-17(16)11-20(19)25)22(26)18-8-4-5-9-21(18)27-14-15-6-2-1-3-7-15/h1-9,16-17,19-20,24-25H,10-14H2/t16-,17+,19-,20-/m1/s1 |
| InChIKey | JCEMRJNMVAWFLH-PIKOESSRSA-N |
| XLogP | 2.47 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |