C15H12Br2O2 — CID 87515751
2,2-dibromo-1-(2-phenylmethoxyphenyl)ethanone (PubChem CID 87515751) has the molecular formula C15H12Br2O2 and a molecular weight of 384.07 g/mol. Its IUPAC name is 2,2-dibromo-1-(2-phenylmethoxyphenyl)ethanone.
| Compound Name | 2,2-dibromo-1-(2-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 87515751 |
| Molecular Formula | C15H12Br2O2 |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | 2,2-dibromo-1-(2-phenylmethoxyphenyl)ethanone |
| SMILES | O=C(c1ccccc1OCc1ccccc1)C(Br)Br |
| InChI | InChI=1S/C15H12Br2O2/c16-15(17)14(18)12-8-4-5-9-13(12)19-10-11-6-2-1-3-7-11/h1-9,15H,10H2 |
| InChIKey | LROLNDGTEHUANM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|