C22H26N2O4 — CID 72912891
(3aR,5R,6S,7aS)-5,6-dihydroxy-N-(3-phenylmethoxyphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 72912891) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (3aR,5R,6S,7aS)-5,6-dihydroxy-N-(3-phenylmethoxyphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aR,5R,6S,7aS)-5,6-dihydroxy-N-(3-phenylmethoxyphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 72912891 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (3aR,5R,6S,7aS)-5,6-dihydroxy-N-(3-phenylmethoxyphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2ccccc2)c1)N1C[C@H]2C[C@H](O)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C22H26N2O4/c25-20-9-16-12-24(13-17(16)10-21(20)26)22(27)23-18-7-4-8-19(11-18)28-14-15-5-2-1-3-6-15/h1-8,11,16-17,20-21,25-26H,9-10,12-14H2,(H,23,27)/t16-,17+,20+,21- |
| InChIKey | KMNWEGQLZHLNNH-BTYSMDAFSA-N |
| XLogP | 2.86 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |