C21H24N4O3 — CID 97270635
(9aS)-9-oxo-N-(3-phenylmethoxyphenyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 97270635) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is (9aS)-9-oxo-N-(3-phenylmethoxyphenyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (9aS)-9-oxo-N-(3-phenylmethoxyphenyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 97270635 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (9aS)-9-oxo-N-(3-phenylmethoxyphenyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C1NCCN2CCN(C(=O)Nc3cccc(OCc4ccccc4)c3)C[C@@H]12 |
| InChI | InChI=1S/C21H24N4O3/c26-20-19-14-25(12-11-24(19)10-9-22-20)21(27)23-17-7-4-8-18(13-17)28-15-16-5-2-1-3-6-16/h1-8,13,19H,9-12,14-15H2,(H,22,26)(H,23,27)/t19-/m0/s1 |
| InChIKey | JDVQHSHCZOFZKM-IBGZPJMESA-N |
| XLogP | 1.91 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |