C21H25FN2O4 — CID 75393732
N-[3-[(4-fluorophenyl)methoxy]phenyl]-3-(3-methoxypropoxy)azetidine-1-carboxamide (PubChem CID 75393732) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methoxy]phenyl]-3-(3-methoxypropoxy)azetidine-1-carboxamide.
| Compound Name | N-[3-[(4-fluorophenyl)methoxy]phenyl]-3-(3-methoxypropoxy)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 75393732 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methoxy]phenyl]-3-(3-methoxypropoxy)azetidine-1-carboxamide |
| SMILES | COCCCOC1CN(C(=O)Nc2cccc(OCc3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C21H25FN2O4/c1-26-10-3-11-27-20-13-24(14-20)21(25)23-18-4-2-5-19(12-18)28-15-16-6-8-17(22)9-7-16/h2,4-9,12,20H,3,10-11,13-15H2,1H3,(H,23,25) |
| InChIKey | HMYXXCKTKPHTDC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|