C16H22N2O5 — CID 122076774
1-[[3-(2-methoxyethoxy)phenyl]carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122076774) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-[[3-(2-methoxyethoxy)phenyl]carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[3-(2-methoxyethoxy)phenyl]carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122076774 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-[[3-(2-methoxyethoxy)phenyl]carbamoyl]piperidine-3-carboxylic acid |
| SMILES | COCCOc1cccc(NC(=O)N2CCCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C16H22N2O5/c1-22-8-9-23-14-6-2-5-13(10-14)17-16(21)18-7-3-4-12(11-18)15(19)20/h2,5-6,10,12H,3-4,7-9,11H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | KAWOEYDFVSZKST-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|