C18H27N3O4 — CID 95297501
(3R)-N-[3-(2-methoxyethoxy)phenyl]-3-(propanoylamino)piperidine-1-carboxamide (PubChem CID 95297501) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3R)-N-[3-(2-methoxyethoxy)phenyl]-3-(propanoylamino)piperidine-1-carboxamide.
| Compound Name | (3R)-N-[3-(2-methoxyethoxy)phenyl]-3-(propanoylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95297501 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (3R)-N-[3-(2-methoxyethoxy)phenyl]-3-(propanoylamino)piperidine-1-carboxamide |
| SMILES | CCC(=O)N[C@@H]1CCCN(C(=O)Nc2cccc(OCCOC)c2)C1 |
| InChI | InChI=1S/C18H27N3O4/c1-3-17(22)19-15-7-5-9-21(13-15)18(23)20-14-6-4-8-16(12-14)25-11-10-24-2/h4,6,8,12,15H,3,5,7,9-11,13H2,1-2H3,(H,19,22)(H,20,23)/t15-/m1/s1 |
| InChIKey | BHPIAKWQVQYNKQ-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|