C16H23N3O3 — CID 95139124
(3S)-N-(3-methoxyphenyl)-3-(propanoylamino)piperidine-1-carboxamide (PubChem CID 95139124) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3S)-N-(3-methoxyphenyl)-3-(propanoylamino)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(3-methoxyphenyl)-3-(propanoylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95139124 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3S)-N-(3-methoxyphenyl)-3-(propanoylamino)piperidine-1-carboxamide |
| SMILES | CCC(=O)N[C@H]1CCCN(C(=O)Nc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-15(20)17-13-7-5-9-19(11-13)16(21)18-12-6-4-8-14(10-12)22-2/h4,6,8,10,13H,3,5,7,9,11H2,1-2H3,(H,17,20)(H,18,21)/t13-/m0/s1 |
| InChIKey | OZPLQRUMFVYGDG-ZDUSSCGKSA-N |
| XLogP | 2.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |