C18H27N3O4 — CID 95572739
(3S)-1-N-[3-(2-methoxyethoxy)phenyl]-3-N,3-N-dimethylpiperidine-1,3-dicarboxamide (PubChem CID 95572739) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3S)-1-N-[3-(2-methoxyethoxy)phenyl]-3-N,3-N-dimethylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-[3-(2-methoxyethoxy)phenyl]-3-N,3-N-dimethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95572739 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (3S)-1-N-[3-(2-methoxyethoxy)phenyl]-3-N,3-N-dimethylpiperidine-1,3-dicarboxamide |
| SMILES | COCCOc1cccc(NC(=O)N2CCC[C@H](C(=O)N(C)C)C2)c1 |
| InChI | InChI=1S/C18H27N3O4/c1-20(2)17(22)14-6-5-9-21(13-14)18(23)19-15-7-4-8-16(12-15)25-11-10-24-3/h4,7-8,12,14H,5-6,9-11,13H2,1-3H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | DLVVXNQBESFESR-AWEZNQCLSA-N |
| XLogP | 2.04 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|