C21H26N2O4 — CID 72904447
3-(2,6-dimethylphenoxy)-N-[3-(2-methoxyethoxy)phenyl]azetidine-1-carboxamide (PubChem CID 72904447) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-(2,6-dimethylphenoxy)-N-[3-(2-methoxyethoxy)phenyl]azetidine-1-carboxamide.
| Compound Name | 3-(2,6-dimethylphenoxy)-N-[3-(2-methoxyethoxy)phenyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 72904447 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-(2,6-dimethylphenoxy)-N-[3-(2-methoxyethoxy)phenyl]azetidine-1-carboxamide |
| SMILES | COCCOc1cccc(NC(=O)N2CC(Oc3c(C)cccc3C)C2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-15-6-4-7-16(2)20(15)27-19-13-23(14-19)21(24)22-17-8-5-9-18(12-17)26-11-10-25-3/h4-9,12,19H,10-11,13-14H2,1-3H3,(H,22,24) |
| InChIKey | OXJXGWQDVWYIKP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|