C16H21FN2O2 — CID 97225832
(3aR,6aR)-N-[3-(2-fluoroethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 97225832) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is (3aR,6aR)-N-[3-(2-fluoroethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aR)-N-[3-(2-fluoroethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97225832 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (3aR,6aR)-N-[3-(2-fluoroethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cccc(OCCF)c1)N1C[C@@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C16H21FN2O2/c17-7-8-21-15-6-2-5-14(9-15)18-16(20)19-10-12-3-1-4-13(12)11-19/h2,5-6,9,12-13H,1,3-4,7-8,10-11H2,(H,18,20)/t12-,13-/m0/s1 |
| InChIKey | CGEYTCHPKNHCOX-STQMWFEESA-N |
| XLogP | 3.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |