N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride

C9H9ClFNO2 — CID 130015965

IUPACN-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride
SMILESO=C(Cl)Nc1cccc(OCCF)c1
InChIInChI=1S/C9H9ClFNO2/c10-9(13)12-7-2-1-3-8(6-7)14-5-4-11/h1-3,6H,4-5H2,(H,12,13)
InChIKeyGBFOAHXICDBHLN-UHFFFAOYSA-N
MW217.63 g/mol
LogP2.81
Rot. Bonds4

About N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride

N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride (PubChem CID 130015965) has the molecular formula C9H9ClFNO2 and a molecular weight of 217.63 g/mol. Its IUPAC name is N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride.

Molecular Properties

Compound NameN-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride
PubChem CID130015965
Molecular FormulaC9H9ClFNO2
Molecular Weight217.63 g/mol
Exact Mass217.03
IUPAC NameN-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride
SMILESO=C(Cl)Nc1cccc(OCCF)c1
InChIInChI=1S/C9H9ClFNO2/c10-9(13)12-7-2-1-3-8(6-7)14-5-4-11/h1-3,6H,4-5H2,(H,12,13)
InChIKeyGBFOAHXICDBHLN-UHFFFAOYSA-N
XLogP2.81
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.63
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride?
The IUPAC name of N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride (CID 130015965) is N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride.
What is the SMILES notation for N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride?
The canonical SMILES for N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride is O=C(Cl)Nc1cccc(OCCF)c1.
What is the InChIKey of N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride?
The InChIKey is GBFOAHXICDBHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClFNO2/c10-9(13)12-7-2-1-3-8(6-7)14-5-4-11/h1-3,6H,4-5H2,(H,12,13).
What are the key properties of N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride?
N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride has a molecular weight of 217.63 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride is sourced from PubChem (CID 130015965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).