C9H9ClFNO2 — CID 130015965
N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride (PubChem CID 130015965) has the molecular formula C9H9ClFNO2 and a molecular weight of 217.63 g/mol. Its IUPAC name is N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride.
| Compound Name | N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride |
|---|---|
| PubChem CID | 130015965 |
| Molecular Formula | C9H9ClFNO2 |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | N-[3-(2-fluoroethoxy)phenyl]carbamoyl chloride |
| SMILES | O=C(Cl)Nc1cccc(OCCF)c1 |
| InChI | InChI=1S/C9H9ClFNO2/c10-9(13)12-7-2-1-3-8(6-7)14-5-4-11/h1-3,6H,4-5H2,(H,12,13) |
| InChIKey | GBFOAHXICDBHLN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|