2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid

C16H22FNO4 — CID 119163768

IUPAC2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid
SMILESCCC(CC)(CC(=O)Nc1cccc(OCCF)c1)C(=O)O
InChIInChI=1S/C16H22FNO4/c1-3-16(4-2,15(20)21)11-14(19)18-12-6-5-7-13(10-12)22-9-8-17/h5-7,10H,3-4,8-9,11H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyHDZTVPRCYXMTGB-UHFFFAOYSA-N
MW311.35 g/mol
LogP3.25
Rot. Bonds9

About 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid

2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid (PubChem CID 119163768) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid.

Molecular Properties

Compound Name2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid
PubChem CID119163768
Molecular FormulaC16H22FNO4
Molecular Weight311.35 g/mol
Exact Mass311.15
IUPAC Name2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid
SMILESCCC(CC)(CC(=O)Nc1cccc(OCCF)c1)C(=O)O
InChIInChI=1S/C16H22FNO4/c1-3-16(4-2,15(20)21)11-14(19)18-12-6-5-7-13(10-12)22-9-8-17/h5-7,10H,3-4,8-9,11H2,1-2H3,(H,18,19)(H,20,21)
InChIKeyHDZTVPRCYXMTGB-UHFFFAOYSA-N
XLogP3.25
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.35
LogP ≤ 53.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid?
The IUPAC name of 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid (CID 119163768) is 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid.
What is the SMILES notation for 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid?
The canonical SMILES for 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid is CCC(CC)(CC(=O)Nc1cccc(OCCF)c1)C(=O)O.
What is the InChIKey of 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid?
The InChIKey is HDZTVPRCYXMTGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FNO4/c1-3-16(4-2,15(20)21)11-14(19)18-12-6-5-7-13(10-12)22-9-8-17/h5-7,10H,3-4,8-9,11H2,1-2H3,(H,18,19)(H,20,21).
What are the key properties of 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid?
2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid has a molecular weight of 311.35 g/mol, XLogP of 3.25, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-4-[3-(2-fluoroethoxy)anilino]-4-oxobutanoic acid is sourced from PubChem (CID 119163768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).