C25H32N2O3 — CID 172655427
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-phenylethoxy)phenyl]methanone (PubChem CID 172655427) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-phenylethoxy)phenyl]methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-phenylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 172655427 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-phenylethoxy)phenyl]methanone |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3ccccc3OCCc3ccccc3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C25H32N2O3/c1-26(2)22-14-19-16-27(17-20(19)15-23(22)28)25(29)21-10-6-7-11-24(21)30-13-12-18-8-4-3-5-9-18/h3-11,19-20,22-23,28H,12-17H2,1-2H3/t19-,20+,22-,23-/m1/s1 |
| InChIKey | XKCLEGRJAXGXRG-IRMYBRCSSA-N |
| XLogP | 3.08 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |