C19H25N5O2 — CID 172666125
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 172666125) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 172666125 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3ccccc3-n3cncn3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C19H25N5O2/c1-22(2)17-7-13-9-23(10-14(13)8-18(17)25)19(26)15-5-3-4-6-16(15)24-12-20-11-21-24/h3-6,11-14,17-18,25H,7-10H2,1-2H3/t13-,14+,17-,18-/m1/s1 |
| InChIKey | SEKXULAMSNEISG-LTCOOKNTSA-N |
| XLogP | 1.04 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |