C18H24F3N3O4 — CID 172910814
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone;formic acid (PubChem CID 172910814) has the molecular formula C18H24F3N3O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone;formic acid.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone;formic acid |
|---|---|
| PubChem CID | 172910814 |
| Molecular Formula | C18H24F3N3O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(trifluoromethyl)-3-pyridinyl]methanone;formic acid |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3cnccc3C(F)(F)F)C[C@@H]2C[C@H]1O.O=CO |
| InChI | InChI=1S/C17H22F3N3O2.CH2O2/c1-22(2)14-5-10-8-23(9-11(10)6-15(14)24)16(25)12-7-21-4-3-13(12)17(18,19)20;2-1-3/h3-4,7,10-11,14-15,24H,5-6,8-9H2,1-2H3;1H,(H,2,3)/t10-,11+,14-,15-;/m1./s1 |
| InChIKey | UTPUFSNIUWRFGZ-NWGQJQPPSA-N |
| XLogP | 1.57 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|