C20H32N4O6 — CID 172913216
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(imidazol-1-ylmethyl)cyclopropyl]methanone;formic acid (PubChem CID 172913216) has the molecular formula C20H32N4O6 and a molecular weight of 424.50 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(imidazol-1-ylmethyl)cyclopropyl]methanone;formic acid.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(imidazol-1-ylmethyl)cyclopropyl]methanone;formic acid |
|---|---|
| PubChem CID | 172913216 |
| Molecular Formula | C20H32N4O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(imidazol-1-ylmethyl)cyclopropyl]methanone;formic acid |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)C3(Cn4ccnc4)CC3)C[C@@H]2C[C@H]1O.O=CO.O=CO |
| InChI | InChI=1S/C18H28N4O2.2CH2O2/c1-20(2)15-7-13-9-22(10-14(13)8-16(15)23)17(24)18(3-4-18)11-21-6-5-19-12-21;2*2-1-3/h5-6,12-16,23H,3-4,7-11H2,1-2H3;2*1H,(H,2,3)/t13-,14+,15-,16-;;/m1../s1 |
| InChIKey | WTAMGXLLVZQUSO-QCDIAWODSA-N |
| XLogP | 0.22 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|