C16H20N6O2 — CID 118768437
[1-(imidazol-1-ylmethyl)cyclopropyl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone (PubChem CID 118768437) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is [1-(imidazol-1-ylmethyl)cyclopropyl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone.
| Compound Name | [1-(imidazol-1-ylmethyl)cyclopropyl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 118768437 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [1-(imidazol-1-ylmethyl)cyclopropyl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
| SMILES | O=C(N1CC[C@H]2[C@H](C1)OCc1cnnn12)C1(Cn2ccnc2)CC1 |
| InChI | InChI=1S/C16H20N6O2/c23-15(16(2-3-16)10-20-6-4-17-11-20)21-5-1-13-14(8-21)24-9-12-7-18-19-22(12)13/h4,6-7,11,13-14H,1-3,5,8-10H2/t13-,14-/m0/s1 |
| InChIKey | MKCYQDRNCSGECD-KBPBESRZSA-N |
| XLogP | 0.63 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |