C14H16N6O2S — CID 118771922
(2-methylsulfanylpyrimidin-5-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone (PubChem CID 118771922) has the molecular formula C14H16N6O2S and a molecular weight of 332.39 g/mol. Its IUPAC name is (2-methylsulfanylpyrimidin-5-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone.
| Compound Name | (2-methylsulfanylpyrimidin-5-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 118771922 |
| Molecular Formula | C14H16N6O2S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (2-methylsulfanylpyrimidin-5-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
| SMILES | CSc1ncc(C(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)cn1 |
| InChI | InChI=1S/C14H16N6O2S/c1-23-14-15-4-9(5-16-14)13(21)19-3-2-11-12(7-19)22-8-10-6-17-18-20(10)11/h4-6,11-12H,2-3,7-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | JMKWYGKTRDQNPE-RYUDHWBXSA-N |
| XLogP | 0.78 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |