C21H19FN4O2 — CID 118779013
[2-(2-fluorophenyl)phenyl]-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone (PubChem CID 118779013) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is [2-(2-fluorophenyl)phenyl]-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone.
| Compound Name | [2-(2-fluorophenyl)phenyl]-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 118779013 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [2-(2-fluorophenyl)phenyl]-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone |
| SMILES | O=C(c1ccccc1-c1ccccc1F)N1CC[C@H]2OCc3cnnn3[C@H]2C1 |
| InChI | InChI=1S/C21H19FN4O2/c22-18-8-4-3-6-16(18)15-5-1-2-7-17(15)21(27)25-10-9-20-19(12-25)26-14(13-28-20)11-23-24-26/h1-8,11,19-20H,9-10,12-13H2/t19-,20+/m0/s1 |
| InChIKey | HQEAUDWNJYGEGX-VQTJNVASSA-N |
| XLogP | 3.07 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |