C16H19N5O4S — CID 118786383
4-methyl-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-12-carbonyl]benzenesulfonamide (PubChem CID 118786383) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is 4-methyl-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-12-carbonyl]benzenesulfonamide.
| Compound Name | 4-methyl-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-12-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118786383 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-methyl-3-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-12-carbonyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)N1CC[C@@H]2OCc3cnnn3[C@H]2C1 |
| InChI | InChI=1S/C16H19N5O4S/c1-10-2-3-12(26(17,23)24)6-13(10)16(22)20-5-4-15-14(8-20)21-11(9-25-15)7-18-19-21/h2-3,6-7,14-15H,4-5,8-9H2,1H3,(H2,17,23,24)/t14-,15-/m0/s1 |
| InChIKey | SXDVXVXZYDEFNX-GJZGRUSLSA-N |
| XLogP | 0.22 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |