C14H20N2O4S — CID 124606077
4-methyl-3-[(2R)-2-methyl-1,4-oxazepane-4-carbonyl]benzenesulfonamide (PubChem CID 124606077) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-methyl-3-[(2R)-2-methyl-1,4-oxazepane-4-carbonyl]benzenesulfonamide.
| Compound Name | 4-methyl-3-[(2R)-2-methyl-1,4-oxazepane-4-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124606077 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-methyl-3-[(2R)-2-methyl-1,4-oxazepane-4-carbonyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)N1CCCO[C@H](C)C1 |
| InChI | InChI=1S/C14H20N2O4S/c1-10-4-5-12(21(15,18)19)8-13(10)14(17)16-6-3-7-20-11(2)9-16/h4-5,8,11H,3,6-7,9H2,1-2H3,(H2,15,18,19)/t11-/m1/s1 |
| InChIKey | IKLNENLIJXNFIN-LLVKDONJSA-N |
| XLogP | 0.89 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |