C13H20N6O3 — CID 118766130
1,1-dimethyl-3-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]urea (PubChem CID 118766130) has the molecular formula C13H20N6O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 118766130 |
| Molecular Formula | C13H20N6O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]urea |
| SMILES | CN(C)C(=O)NCC(=O)N1CC[C@H]2OCc3cnnn3[C@H]2C1 |
| InChI | InChI=1S/C13H20N6O3/c1-17(2)13(21)14-6-12(20)18-4-3-11-10(7-18)19-9(8-22-11)5-15-16-19/h5,10-11H,3-4,6-8H2,1-2H3,(H,14,21)/t10-,11+/m0/s1 |
| InChIKey | CKHMMQPIIDHNHR-WDEREUQCSA-N |
| XLogP | -0.78 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |