C16H18N4O3S — CID 118793205
2-(5-acetylthiophen-3-yl)-1-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]ethanone (PubChem CID 118793205) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-(5-acetylthiophen-3-yl)-1-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]ethanone.
| Compound Name | 2-(5-acetylthiophen-3-yl)-1-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]ethanone |
|---|---|
| PubChem CID | 118793205 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-(5-acetylthiophen-3-yl)-1-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]ethanone |
| SMILES | CC(=O)c1cc(CC(=O)N2CC[C@H]3OCc4cnnn4[C@H]3C2)cs1 |
| InChI | InChI=1S/C16H18N4O3S/c1-10(21)15-4-11(9-24-15)5-16(22)19-3-2-14-13(7-19)20-12(8-23-14)6-17-18-20/h4,6,9,13-14H,2-3,5,7-8H2,1H3/t13-,14+/m0/s1 |
| InChIKey | SIJPZBZYELYLDJ-UONOGXRCSA-N |
| XLogP | 1.46 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |