C15H18N6O4 — CID 118790380
3-methyl-5-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione (PubChem CID 118790380) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-methyl-5-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-methyl-5-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118790380 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-methyl-5-[2-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]cc(CC(=O)N2CC[C@H]3OCc4cnnn4[C@H]3C2)c1=O |
| InChI | InChI=1S/C15H18N6O4/c1-19-14(23)9(5-16-15(19)24)4-13(22)20-3-2-12-11(7-20)21-10(8-25-12)6-17-18-21/h5-6,11-12H,2-4,7-8H2,1H3,(H,16,24)/t11-,12+/m0/s1 |
| InChIKey | GFSPISDOPCZGGA-NWDGAFQWSA-N |
| XLogP | -1.42 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |