C15H20N6O4 — CID 118776574
5,5-dimethyl-3-[2-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 118776574) has the molecular formula C15H20N6O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118776574 |
| Molecular Formula | C15H20N6O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 5,5-dimethyl-3-[2-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)C1=O |
| InChI | InChI=1S/C15H20N6O4/c1-15(2)13(23)20(14(24)17-15)7-12(22)19-4-3-10-11(6-19)25-8-9-5-16-18-21(9)10/h5,10-11H,3-4,6-8H2,1-2H3,(H,17,24)/t10-,11-/m0/s1 |
| InChIKey | KMXRSXLRAKUSLB-QWRGUYRKSA-N |
| XLogP | -0.72 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|