C16H16F2N4O3 — CID 118784694
(2,6-difluoro-4-methoxyphenyl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone (PubChem CID 118784694) has the molecular formula C16H16F2N4O3 and a molecular weight of 350.33 g/mol. Its IUPAC name is (2,6-difluoro-4-methoxyphenyl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone.
| Compound Name | (2,6-difluoro-4-methoxyphenyl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 118784694 |
| Molecular Formula | C16H16F2N4O3 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (2,6-difluoro-4-methoxyphenyl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
| SMILES | COc1cc(F)c(C(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)c(F)c1 |
| InChI | InChI=1S/C16H16F2N4O3/c1-24-10-4-11(17)15(12(18)5-10)16(23)21-3-2-13-14(7-21)25-8-9-6-19-20-22(9)13/h4-6,13-14H,2-3,7-8H2,1H3/t13-,14-/m0/s1 |
| InChIKey | RVPPMBXFCMZNHV-KBPBESRZSA-N |
| XLogP | 1.55 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |