C15H20N6O2S — CID 118787336
[2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone (PubChem CID 118787336) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is [2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone.
| Compound Name | [2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 118787336 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
| SMILES | CCNc1nc(C)c(C(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)s1 |
| InChI | InChI=1S/C15H20N6O2S/c1-3-16-15-18-9(2)13(24-15)14(22)20-5-4-11-12(7-20)23-8-10-6-17-19-21(10)11/h6,11-12H,3-5,7-8H2,1-2H3,(H,16,18)/t11-,12-/m0/s1 |
| InChIKey | UKJGDZDVKYWRHA-RYUDHWBXSA-N |
| XLogP | 1.46 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |