C19H19N5O3 — CID 118770764
(2-methoxyquinolin-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone (PubChem CID 118770764) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2-methoxyquinolin-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone.
| Compound Name | (2-methoxyquinolin-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 118770764 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (2-methoxyquinolin-4-yl)-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]methanone |
| SMILES | COc1cc(C(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)c2ccccc2n1 |
| InChI | InChI=1S/C19H19N5O3/c1-26-18-8-14(13-4-2-3-5-15(13)21-18)19(25)23-7-6-16-17(10-23)27-11-12-9-20-22-24(12)16/h2-5,8-9,16-17H,6-7,10-11H2,1H3/t16-,17-/m0/s1 |
| InChIKey | OCNMOTGEILPRRY-IRXDYDNUSA-N |
| XLogP | 1.82 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |