C21H25N3O3 — CID 134701449
[(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-methoxyquinolin-4-yl)methanone (PubChem CID 134701449) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-methoxyquinolin-4-yl)methanone.
| Compound Name | [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-methoxyquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 134701449 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(2-methoxyquinolin-4-yl)methanone |
| SMILES | COc1cc(C(=O)N2CCN3[C@@H](COC[C@@H]3C3CC3)C2)c2ccccc2n1 |
| InChI | InChI=1S/C21H25N3O3/c1-26-20-10-17(16-4-2-3-5-18(16)22-20)21(25)23-8-9-24-15(11-23)12-27-13-19(24)14-6-7-14/h2-5,10,14-15,19H,6-9,11-13H2,1H3/t15-,19-/m1/s1 |
| InChIKey | OIBOYIQUNPEVLS-DNVCBOLYSA-N |
| XLogP | 2.18 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |