C18H21N3O3 — CID 177077672
(2-methoxyquinolin-4-yl)-[4-(oxetan-3-yl)piperazin-1-yl]methanone (PubChem CID 177077672) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2-methoxyquinolin-4-yl)-[4-(oxetan-3-yl)piperazin-1-yl]methanone.
| Compound Name | (2-methoxyquinolin-4-yl)-[4-(oxetan-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 177077672 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2-methoxyquinolin-4-yl)-[4-(oxetan-3-yl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(C3COC3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C18H21N3O3/c1-23-17-10-15(14-4-2-3-5-16(14)19-17)18(22)21-8-6-20(7-9-21)13-11-24-12-13/h2-5,10,13H,6-9,11-12H2,1H3 |
| InChIKey | FEUOKHZGRFDTBD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |