C18H22N2O3 — CID 138034545
(2,2-dimethyl-1,4-oxazepan-4-yl)-(2-methoxyquinolin-4-yl)methanone (PubChem CID 138034545) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2,2-dimethyl-1,4-oxazepan-4-yl)-(2-methoxyquinolin-4-yl)methanone.
| Compound Name | (2,2-dimethyl-1,4-oxazepan-4-yl)-(2-methoxyquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 138034545 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2,2-dimethyl-1,4-oxazepan-4-yl)-(2-methoxyquinolin-4-yl)methanone |
| SMILES | COc1cc(C(=O)N2CCCOC(C)(C)C2)c2ccccc2n1 |
| InChI | InChI=1S/C18H22N2O3/c1-18(2)12-20(9-6-10-23-18)17(21)14-11-16(22-3)19-15-8-5-4-7-13(14)15/h4-5,7-8,11H,6,9-10,12H2,1-3H3 |
| InChIKey | GKDRUPZYIYYAHL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |