C20H24N4O2 — CID 155919413
[(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone (PubChem CID 155919413) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone.
| Compound Name | [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 155919413 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [(4S,9aR)-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccccc1-c1ncc[nH]1)N1CCN2[C@@H](COC[C@@H]2C2CC2)C1 |
| InChI | InChI=1S/C20H24N4O2/c25-20(17-4-2-1-3-16(17)19-21-7-8-22-19)23-9-10-24-15(11-23)12-26-13-18(24)14-5-6-14/h1-4,7-8,14-15,18H,5-6,9-13H2,(H,21,22)/t15-,18-/m1/s1 |
| InChIKey | YSYGQLSBTHUHDC-CRAIPNDOSA-N |
| XLogP | 2.01 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |