C16H18N4O2S — CID 118776033
(2-methylsulfanylphenyl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone (PubChem CID 118776033) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is (2-methylsulfanylphenyl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone.
| Compound Name | (2-methylsulfanylphenyl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 118776033 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2-methylsulfanylphenyl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone |
| SMILES | CSc1ccccc1C(=O)N1CC[C@H]2OCc3cnnn3[C@H]2C1 |
| InChI | InChI=1S/C16H18N4O2S/c1-23-15-5-3-2-4-12(15)16(21)19-7-6-14-13(9-19)20-11(10-22-14)8-17-18-20/h2-5,8,13-14H,6-7,9-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | DAQGZAVUAZAQFF-UONOGXRCSA-N |
| XLogP | 1.99 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |