C14H17ClN6O2 — CID 118773391
(4-chloro-1-ethylpyrazol-5-yl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone (PubChem CID 118773391) has the molecular formula C14H17ClN6O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 118773391 |
| Molecular Formula | C14H17ClN6O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-[(1S,9R)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]methanone |
| SMILES | CCn1ncc(Cl)c1C(=O)N1CC[C@H]2OCc3cnnn3[C@H]2C1 |
| InChI | InChI=1S/C14H17ClN6O2/c1-2-20-13(10(15)6-17-20)14(22)19-4-3-12-11(7-19)21-9(8-23-12)5-16-18-21/h5-6,11-12H,2-4,7-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | KHUFNFYIECOQOY-NWDGAFQWSA-N |
| XLogP | 1.13 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |