C16H17Cl2N3O2 — CID 95196647
(4-chloro-1-ethylpyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone (PubChem CID 95196647) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 95196647 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone |
| SMILES | CCn1ncc(Cl)c1C(=O)N1CCO[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H17Cl2N3O2/c1-2-21-15(13(18)9-19-21)16(22)20-7-8-23-14(10-20)11-3-5-12(17)6-4-11/h3-6,9,14H,2,7-8,10H2,1H3/t14-/m0/s1 |
| InChIKey | URSXCZGCBZXBSI-AWEZNQCLSA-N |
| XLogP | 3.42 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |