C17H21N5O4 — CID 118778233
(1S,9S)-N-(2,4-dimethoxyphenyl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide (PubChem CID 118778233) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is (1S,9S)-N-(2,4-dimethoxyphenyl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide.
| Compound Name | (1S,9S)-N-(2,4-dimethoxyphenyl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide |
|---|---|
| PubChem CID | 118778233 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (1S,9S)-N-(2,4-dimethoxyphenyl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CC[C@H]3[C@H](C2)OCc2cnnn23)c(OC)c1 |
| InChI | InChI=1S/C17H21N5O4/c1-24-12-3-4-13(15(7-12)25-2)19-17(23)21-6-5-14-16(9-21)26-10-11-8-18-20-22(11)14/h3-4,7-8,14,16H,5-6,9-10H2,1-2H3,(H,19,23)/t14-,16-/m0/s1 |
| InChIKey | VSSQIAVEZKSAMI-HOCLYGCPSA-N |
| XLogP | 1.67 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |