C15H18N4O2 — CID 59587962
(2R,6R)-4-[(4-methoxyphenyl)methyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 59587962) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R,6R)-4-[(4-methoxyphenyl)methyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-4-[(4-methoxyphenyl)methyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 59587962 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2R,6R)-4-[(4-methoxyphenyl)methyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | COc1ccc(CN2C[C@@H]3[C@@H](C2)OCc2cnnn23)cc1 |
| InChI | InChI=1S/C15H18N4O2/c1-20-13-4-2-11(3-5-13)7-18-8-14-15(9-18)21-10-12-6-16-17-19(12)14/h2-6,14-15H,7-10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | VIVPBSKTQVEXTE-HUUCEWRRSA-N |
| XLogP | 1.24 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |