C14H18N6O3 — CID 118790241
(1S,9S)-11-(4,6-dimethoxypyrimidin-2-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 118790241) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is (1S,9S)-11-(4,6-dimethoxypyrimidin-2-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | (1S,9S)-11-(4,6-dimethoxypyrimidin-2-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 118790241 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (1S,9S)-11-(4,6-dimethoxypyrimidin-2-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | COc1cc(OC)nc(N2CC[C@H]3[C@H](C2)OCc2cnnn23)n1 |
| InChI | InChI=1S/C14H18N6O3/c1-21-12-5-13(22-2)17-14(16-12)19-4-3-10-11(7-19)23-8-9-6-15-18-20(9)10/h5-6,10-11H,3-4,7-8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | ZONPFARPPKCJPJ-QWRGUYRKSA-N |
| XLogP | 0.44 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |