C10H16N4O2 — CID 136582876
(3R)-1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-amine (PubChem CID 136582876) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3R)-1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-amine.
| Compound Name | (3R)-1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 136582876 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (3R)-1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-amine |
| SMILES | COc1cc(OC)nc(N2CC[C@@H](N)C2)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-15-8-5-9(16-2)13-10(12-8)14-4-3-7(11)6-14/h5,7H,3-4,6,11H2,1-2H3/t7-/m1/s1 |
| InChIKey | IQIXDKXNRSPAIK-SSDOTTSWSA-N |
| XLogP | 0.03 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |