C12H18FN3O2 — CID 172880777
2-[3-(fluoromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine (PubChem CID 172880777) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-[3-(fluoromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine.
| Compound Name | 2-[3-(fluoromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 172880777 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[3-(fluoromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(N2CCCC(CF)C2)n1 |
| InChI | InChI=1S/C12H18FN3O2/c1-17-10-6-11(18-2)15-12(14-10)16-5-3-4-9(7-13)8-16/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | DLSJJXLGJWRMCS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |