About 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole
2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole (PubChem CID 163357902) has the molecular formula C15H20N4O3S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole |
| PubChem CID | 163357902 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole |
| SMILES | COc1cc(OC)nc(N2CCCC(COc3nccs3)C2)n1 |
| InChI | InChI=1S/C15H20N4O3S/c1-20-12-8-13(21-2)18-14(17-12)19-6-3-4-11(9-19)10-22-15-16-5-7-23-15/h5,7-8,11H,3-4,6,9-10H2,1-2H3 |
| InChIKey | ZLQCHADCHSMLEY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole?
The IUPAC name of 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole (CID 163357902) is 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole.
What is the SMILES notation for 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole?
The canonical SMILES for 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole is COc1cc(OC)nc(N2CCCC(COc3nccs3)C2)n1.
What is the InChIKey of 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole?
The InChIKey is ZLQCHADCHSMLEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O3S/c1-20-12-8-13(21-2)18-14(17-12)19-6-3-4-11(9-19)10-22-15-16-5-7-23-15/h5,7-8,11H,3-4,6,9-10H2,1-2H3.
What are the key properties of 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole?
2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole has a molecular weight of 336.42 g/mol, XLogP of 2.25, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-3-yl]methoxy]-1,3-thiazole is sourced from PubChem (CID 163357902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).